C12H18F4N2O2 — CID 172701655
4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-difluoro-2,2-dimethylbutanoic acid (PubChem CID 172701655) has the molecular formula C12H18F4N2O2 and a molecular weight of 298.28 g/mol. Its IUPAC name is 4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-difluoro-2,2-dimethylbutanoic acid.
| Compound Name | 4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-difluoro-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 172701655 |
| Molecular Formula | C12H18F4N2O2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[(3aS,6aR)-6,6-difluoro-2,3,3a,4,5,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-difluoro-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(C(=O)O)C(F)(F)CN1CC[C@@H]2NCC(F)(F)[C@@H]21 |
| InChI | InChI=1S/C12H18F4N2O2/c1-10(2,9(19)20)12(15,16)6-18-4-3-7-8(18)11(13,14)5-17-7/h7-8,17H,3-6H2,1-2H3,(H,19,20)/t7-,8+/m0/s1 |
| InChIKey | DATLIOSRSFAKBV-JGVFFNPUSA-N |
| XLogP | 1.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |