C13H20F2N2O4 — CID 175771746
prop-2-enyl 2-[[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]methyl]-2-hydroxybutanoate (PubChem CID 175771746) has the molecular formula C13H20F2N2O4 and a molecular weight of 306.31 g/mol. Its IUPAC name is prop-2-enyl 2-[[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]methyl]-2-hydroxybutanoate.
| Compound Name | prop-2-enyl 2-[[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]methyl]-2-hydroxybutanoate |
|---|---|
| PubChem CID | 175771746 |
| Molecular Formula | C13H20F2N2O4 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | prop-2-enyl 2-[[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]methyl]-2-hydroxybutanoate |
| SMILES | C=CCOC(=O)C(O)(CC)CN1OC[C@H]2NCC(F)(F)[C@H]21 |
| InChI | InChI=1S/C13H20F2N2O4/c1-3-5-20-11(18)12(19,4-2)8-17-10-9(6-21-17)16-7-13(10,14)15/h3,9-10,16,19H,1,4-8H2,2H3/t9-,10+,12?/m1/s1 |
| InChIKey | UQKIQLPXVAAUQC-WFCWDVHWSA-N |
| XLogP | 0.08 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|