C15H22F4N2O4 — CID 175771806
prop-2-enyl (3R)-4-[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]-3-(difluoromethoxy)-2,2-dimethylbutanoate (PubChem CID 175771806) has the molecular formula C15H22F4N2O4 and a molecular weight of 370.34 g/mol. Its IUPAC name is prop-2-enyl (3R)-4-[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]-3-(difluoromethoxy)-2,2-dimethylbutanoate.
| Compound Name | prop-2-enyl (3R)-4-[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]-3-(difluoromethoxy)-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 175771806 |
| Molecular Formula | C15H22F4N2O4 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | prop-2-enyl (3R)-4-[(3aS,6aS)-6,6-difluoro-3a,4,5,6a-tetrahydro-3H-pyrrolo[3,2-c][1,2]oxazol-1-yl]-3-(difluoromethoxy)-2,2-dimethylbutanoate |
| SMILES | C=CCOC(=O)C(C)(C)[C@H](CN1OC[C@H]2NCC(F)(F)[C@H]21)OC(F)F |
| InChI | InChI=1S/C15H22F4N2O4/c1-4-5-23-12(22)14(2,3)10(25-13(16)17)6-21-11-9(7-24-21)20-8-15(11,18)19/h4,9-11,13,20H,1,5-8H2,2-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | BIZVJBHAXHYSGR-VWYCJHECSA-N |
| XLogP | 1.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|