C14H23F2N3O5S — CID 163283898
tert-butyl (3aS,6aR)-6,6-difluoro-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 163283898) has the molecular formula C14H23F2N3O5S and a molecular weight of 383.42 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-6,6-difluoro-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-6,6-difluoro-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 163283898 |
| Molecular Formula | C14H23F2N3O5S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | tert-butyl (3aS,6aR)-6,6-difluoro-1-[2-(methanesulfonamido)-2-oxoethyl]-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)[C@H]2[C@@H]1CCN2CC(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C14H23F2N3O5S/c1-13(2,3)24-12(21)19-8-14(15,16)11-9(19)5-6-18(11)7-10(20)17-25(4,22)23/h9,11H,5-8H2,1-4H3,(H,17,20)/t9-,11+/m0/s1 |
| InChIKey | XSCPGFBIVAGRCS-GXSJLCMTSA-N |
| XLogP | 0.39 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |