C20H12ClF3O3 — CID 163212046
5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde (PubChem CID 163212046) has the molecular formula C20H12ClF3O3 and a molecular weight of 392.76 g/mol. Its IUPAC name is 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde.
| Compound Name | 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 163212046 |
| Molecular Formula | C20H12ClF3O3 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cc(Cl)c(OCc2cccc(-c3cc(F)ccc3F)c2F)cc1O |
| InChI | InChI=1S/C20H12ClF3O3/c21-16-6-12(9-25)18(26)8-19(16)27-10-11-2-1-3-14(20(11)24)15-7-13(22)4-5-17(15)23/h1-9,26H,10H2 |
| InChIKey | NOJGIWSVKNSRGA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|