About 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde
5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde (PubChem CID 163212046) has the molecular formula C20H12ClF3O3
and a molecular weight of 392.76 g/mol. Its IUPAC name is 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde |
| PubChem CID | 163212046 |
| Molecular Formula | C20H12ClF3O3 |
| Molecular Weight | 392.76 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1cc(Cl)c(OCc2cccc(-c3cc(F)ccc3F)c2F)cc1O |
| InChI | InChI=1S/C20H12ClF3O3/c21-16-6-12(9-25)18(26)8-19(16)27-10-11-2-1-3-14(20(11)24)15-7-13(22)4-5-17(15)23/h1-9,26H,10H2 |
| InChIKey | NOJGIWSVKNSRGA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.76 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde?
The IUPAC name of 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde (CID 163212046) is 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde.
What is the SMILES notation for 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde?
The canonical SMILES for 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde is O=Cc1cc(Cl)c(OCc2cccc(-c3cc(F)ccc3F)c2F)cc1O.
What is the InChIKey of 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde?
The InChIKey is NOJGIWSVKNSRGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12ClF3O3/c21-16-6-12(9-25)18(26)8-19(16)27-10-11-2-1-3-14(20(11)24)15-7-13(22)4-5-17(15)23/h1-9,26H,10H2.
What are the key properties of 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde?
5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde has a molecular weight of 392.76 g/mol, XLogP of 5.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[[3-(2,5-difluorophenyl)-2-fluorophenyl]methoxy]-2-hydroxybenzaldehyde is sourced from PubChem (CID 163212046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).