C21H23N6O7PS — CID 163214002
N-[9-[(2S,3S,4R,5R)-2-(2-cyanoethoxysulfanylphosphanyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide (PubChem CID 163214002) has the molecular formula C21H23N6O7PS and a molecular weight of 534.49 g/mol. Its IUPAC name is N-[9-[(2S,3S,4R,5R)-2-(2-cyanoethoxysulfanylphosphanyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(2S,3S,4R,5R)-2-(2-cyanoethoxysulfanylphosphanyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 163214002 |
| Molecular Formula | C21H23N6O7PS |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | N-[9-[(2S,3S,4R,5R)-2-(2-cyanoethoxysulfanylphosphanyl)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]purin-6-yl]benzamide |
| SMILES | CO[C@@]1(O)[C@H](O)[C@@H](CO)O[C@@]1(PSOCCC#N)n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C21H23N6O7PS/c1-32-20(31)16(29)14(10-28)34-21(20,35-36-33-9-5-8-22)27-12-25-15-17(23-11-24-18(15)27)26-19(30)13-6-3-2-4-7-13/h2-4,6-7,11-12,14,16,28-29,31,35H,5,9-10H2,1H3,(H,23,24,26,30)/t14-,16-,20+,21+/m1/s1 |
| InChIKey | JMVIUDFURHNVEL-GNBIQWSPSA-N |
| XLogP | 0.95 |
| TPSA | 184.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|