C20H19N6O4P — CID 166888118
N-[9-[(1S,3R)-6-(2-cyanoethoxyphosphanyloxy)-2-oxabicyclo[3.1.0]hexan-3-yl]purin-6-yl]benzamide (PubChem CID 166888118) has the molecular formula C20H19N6O4P and a molecular weight of 438.38 g/mol. Its IUPAC name is N-[9-[(1S,3R)-6-(2-cyanoethoxyphosphanyloxy)-2-oxabicyclo[3.1.0]hexan-3-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1S,3R)-6-(2-cyanoethoxyphosphanyloxy)-2-oxabicyclo[3.1.0]hexan-3-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 166888118 |
| Molecular Formula | C20H19N6O4P |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[9-[(1S,3R)-6-(2-cyanoethoxyphosphanyloxy)-2-oxabicyclo[3.1.0]hexan-3-yl]purin-6-yl]benzamide |
| SMILES | N#CCCOPOC1C2C[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O[C@@H]21 |
| InChI | InChI=1S/C20H19N6O4P/c21-7-4-8-28-31-30-17-13-9-14(29-16(13)17)26-11-24-15-18(22-10-23-19(15)26)25-20(27)12-5-2-1-3-6-12/h1-3,5-6,10-11,13-14,16-17,31H,4,8-9H2,(H,22,23,25,27)/t13?,14-,16+,17?/m1/s1 |
| InChIKey | JYILXLUZFJQGDJ-HTUOJYHCSA-N |
| XLogP | 2.82 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|