C40H36B2F2N12O10P2 — CID 162474907
CID 162474907 (PubChem CID 162474907) has the molecular formula C40H36B2F2N12O10P2 and a molecular weight of 966.37 g/mol.
| Compound Name | CID 162474907 |
|---|---|
| PubChem CID | 162474907 |
| Molecular Formula | C40H36B2F2N12O10P2 |
| Molecular Weight | 966.37 g/mol |
| Exact Mass | 966.23 |
| IUPAC Name | — |
| SMILES | [B-][P+]1(OCCC#N)OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)C(F)[C@H]2O[P+]([B-])(OCC[N+]#[C-])OC[C@H]2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@@H](F)C2O1 |
| InChI | InChI=1S/C40H34B2F2N12O10P2/c1-46-14-16-60-68(42)62-18-26-31(27(43)39(64-26)55-21-51-29-33(47-19-49-35(29)55)53-37(57)23-9-4-2-5-10-23)65-67(41,59-15-8-13-45)61-17-25-32(66-68)28(44)40(63-25)56-22-52-30-34(48-20-50-36(30)56)54-38(58)24-11-6-3-7-12-24/h2-7,9-12,19-22,25-28,31-32,39-40H,8,14-18H2/q-2/p+2/t25-,26-,27+,28?,31?,32+,39-,40-,67?,68?/m1/s1 |
| InChIKey | GWNZRVDYBFQBAQ-XIGKMYQUSA-P |
| XLogP | 5.02 |
| TPSA | 247.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|