C34H33BF2N11O9P2 — CID 174118179
CID 174118179 (PubChem CID 174118179) has the molecular formula C34H33BF2N11O9P2 and a molecular weight of 850.46 g/mol.
| Compound Name | CID 174118179 |
|---|---|
| PubChem CID | 174118179 |
| Molecular Formula | C34H33BF2N11O9P2 |
| Molecular Weight | 850.46 g/mol |
| Exact Mass | 850.20 |
| IUPAC Name | — |
| SMILES | [B-][P+]1(OCCC#N)OC[C@H]2O[C@@H](n3cnc4c(C)ncnc43)[C@H](F)[C@@H]2OP(OCCC#N)OCC2O[C@@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)[C@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C34H32BF2N11O9P2/c1-19-25-30(42-15-40-19)47(17-44-25)33-23(36)27-22(55-33)14-53-59(35,52-12-6-10-39)57-28-21(13-51-58(56-27)50-11-5-9-38)54-34(24(28)37)48-18-45-26-29(41-16-43-31(26)48)46-32(49)20-7-3-2-4-8-20/h2-4,7-8,15-18,21-24,27-28,33-34H,5-6,11-14H2,1H3/q-1/p+1/t21?,22-,23-,24-,27-,28-,33-,34-,58?,59?/m1/s1 |
| InChIKey | PRDDXGSPWNDDJJ-CBUFICLXSA-O |
| XLogP | 4.45 |
| TPSA | 237.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|