C23H35NO3 — CID 163215089
propyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexanoate (PubChem CID 163215089) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is propyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexanoate.
| Compound Name | propyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexanoate |
|---|---|
| PubChem CID | 163215089 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | propyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexanoate |
| SMILES | CCCCC(C(=O)OCCC)c1ccc(C(=O)C2CCC(CN)CC2)cc1 |
| InChI | InChI=1S/C23H35NO3/c1-3-5-6-21(23(26)27-15-4-2)18-11-13-20(14-12-18)22(25)19-9-7-17(16-24)8-10-19/h11-14,17,19,21H,3-10,15-16,24H2,1-2H3 |
| InChIKey | FXMIZMSZHURFHU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |