C18H25NO3 — CID 54151231
ethyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]acetate (PubChem CID 54151231) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is ethyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]acetate |
|---|---|
| PubChem CID | 54151231 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | ethyl 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(=O)C2CCC(CN)CC2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-2-22-17(20)11-13-3-7-15(8-4-13)18(21)16-9-5-14(12-19)6-10-16/h3-4,7-8,14,16H,2,5-6,9-12,19H2,1H3 |
| InChIKey | OHWOJLPAPIKVGE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |