C22H33NO3 — CID 172830049
2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexyl acetate (PubChem CID 172830049) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexyl acetate.
| Compound Name | 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexyl acetate |
|---|---|
| PubChem CID | 172830049 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 2-[4-[4-(aminomethyl)cyclohexanecarbonyl]phenyl]hexyl acetate |
| SMILES | CCCCC(COC(C)=O)c1ccc(C(=O)C2CCC(CN)CC2)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-3-4-5-21(15-26-16(2)24)18-10-12-20(13-11-18)22(25)19-8-6-17(14-23)7-9-19/h10-13,17,19,21H,3-9,14-15,23H2,1-2H3 |
| InChIKey | VJVGPWMBAPUQBB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |