C15H21BrN4O3 — CID 163216476
tert-butyl 3-[[(4-bromo-2-pyridinyl)amino]carbamoyl]-3-methylazetidine-1-carboxylate (PubChem CID 163216476) has the molecular formula C15H21BrN4O3 and a molecular weight of 385.26 g/mol. Its IUPAC name is tert-butyl 3-[[(4-bromo-2-pyridinyl)amino]carbamoyl]-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(4-bromo-2-pyridinyl)amino]carbamoyl]-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 163216476 |
| Molecular Formula | C15H21BrN4O3 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | tert-butyl 3-[[(4-bromo-2-pyridinyl)amino]carbamoyl]-3-methylazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C(=O)NNc2cc(Br)ccn2)C1 |
| InChI | InChI=1S/C15H21BrN4O3/c1-14(2,3)23-13(22)20-8-15(4,9-20)12(21)19-18-11-7-10(16)5-6-17-11/h5-7H,8-9H2,1-4H3,(H,17,18)(H,19,21) |
| InChIKey | UWXXEYIQWFTKTG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|