C22H17F6N3O3 — CID 163216649
4-[4-[[2,4-bis(trifluoromethyl)phenoxy]methyl]-3-methoxyphenyl]-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-6-one (PubChem CID 163216649) has the molecular formula C22H17F6N3O3 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-[4-[[2,4-bis(trifluoromethyl)phenoxy]methyl]-3-methoxyphenyl]-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 4-[4-[[2,4-bis(trifluoromethyl)phenoxy]methyl]-3-methoxyphenyl]-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 163216649 |
| Molecular Formula | C22H17F6N3O3 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-[4-[[2,4-bis(trifluoromethyl)phenoxy]methyl]-3-methoxyphenyl]-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridin-6-one |
| SMILES | COc1cc(C2CC(=O)Nc3[nH]ncc32)ccc1COc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H17F6N3O3/c1-33-18-6-11(14-8-19(32)30-20-15(14)9-29-31-20)2-3-12(18)10-34-17-5-4-13(21(23,24)25)7-16(17)22(26,27)28/h2-7,9,14H,8,10H2,1H3,(H2,29,30,31,32) |
| InChIKey | KSIGNAAHPQLODH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |