C25H22F6N4O4 — CID 167209482
4-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-N,N-dimethyl-6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 167209482) has the molecular formula C25H22F6N4O4 and a molecular weight of 556.46 g/mol. Its IUPAC name is 4-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-N,N-dimethyl-6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridine-5-carboxamide.
| Compound Name | 4-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-N,N-dimethyl-6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 167209482 |
| Molecular Formula | C25H22F6N4O4 |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 4-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]-N,N-dimethyl-6-oxo-1,4,5,7-tetrahydropyrazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | COc1cc(C2c3cn[nH]c3NC(=O)C2C(=O)N(C)C)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H22F6N4O4/c1-35(2)23(37)20-19(15-10-32-34-21(15)33-22(20)36)12-5-7-17(18(8-12)38-3)39-11-13-4-6-14(24(26,27)28)9-16(13)25(29,30)31/h4-10,19-20H,11H2,1-3H3,(H2,32,33,34,36) |
| InChIKey | DPXNTCCYRIPMAW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|