C22H19F6NO3S2 — CID 163641528
5-[1-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]propan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 163641528) has the molecular formula C22H19F6NO3S2 and a molecular weight of 523.52 g/mol. Its IUPAC name is 5-[1-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]propan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[1-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]propan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 163641528 |
| Molecular Formula | C22H19F6NO3S2 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 5-[1-[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]propan-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(CC(C)C2SC(=S)NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C22H19F6NO3S2/c1-11(18-19(30)29-20(33)34-18)7-12-3-6-16(17(8-12)31-2)32-10-13-4-5-14(21(23,24)25)9-15(13)22(26,27)28/h3-6,8-9,11,18H,7,10H2,1-2H3,(H,29,30,33) |
| InChIKey | IERCTCJHUAZHMY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|