C20H20N6O — CID 163220066
N-cyclopentyl-N-[4-[(2-methylquinolin-4-yl)amino]-3,7-diazabicyclo[4.1.0]hepta-1,3,5-trien-7-yl]nitrous amide (PubChem CID 163220066) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is N-cyclopentyl-N-[4-[(2-methylquinolin-4-yl)amino]-3,7-diazabicyclo[4.1.0]hepta-1,3,5-trien-7-yl]nitrous amide.
| Compound Name | N-cyclopentyl-N-[4-[(2-methylquinolin-4-yl)amino]-3,7-diazabicyclo[4.1.0]hepta-1,3,5-trien-7-yl]nitrous amide |
|---|---|
| PubChem CID | 163220066 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-cyclopentyl-N-[4-[(2-methylquinolin-4-yl)amino]-3,7-diazabicyclo[4.1.0]hepta-1,3,5-trien-7-yl]nitrous amide |
| SMILES | Cc1cc(Nc2cc3c(cn2)N3N(N=O)C2CCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C20H20N6O/c1-13-10-17(15-8-4-5-9-16(15)22-13)23-20-11-18-19(12-21-20)25(18)26(24-27)14-6-2-3-7-14/h4-5,8-12,14H,2-3,6-7H2,1H3,(H,21,22,23) |
| InChIKey | GADJKPGXBLMTPJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|