C35H51N5O3 — CID 163222463
2-amino-4-ethyl-4-methyl-1,5-dihydropyrimidin-6-one;N-[1-[2-(6-aminohexyl)-3,4-dihydro-2H-chromen-6-yl]ethenyl]-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 163222463) has the molecular formula C35H51N5O3 and a molecular weight of 589.83 g/mol. Its IUPAC name is 2-amino-4-ethyl-4-methyl-1,5-dihydropyrimidin-6-one;N-[1-[2-(6-aminohexyl)-3,4-dihydro-2H-chromen-6-yl]ethenyl]-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 2-amino-4-ethyl-4-methyl-1,5-dihydropyrimidin-6-one;N-[1-[2-(6-aminohexyl)-3,4-dihydro-2H-chromen-6-yl]ethenyl]-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 163222463 |
| Molecular Formula | C35H51N5O3 |
| Molecular Weight | 589.83 g/mol |
| Exact Mass | 589.40 |
| IUPAC Name | 2-amino-4-ethyl-4-methyl-1,5-dihydropyrimidin-6-one;N-[1-[2-(6-aminohexyl)-3,4-dihydro-2H-chromen-6-yl]ethenyl]-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | C=C(NC1CC(C)(C)Oc2ccccc21)c1ccc2c(c1)CCC(CCCCCCN)O2.CCC1(C)CC(=O)NC(N)=N1 |
| InChI | InChI=1S/C28H38N2O2.C7H13N3O/c1-20(30-25-19-28(2,3)32-27-12-8-7-11-24(25)27)21-14-16-26-22(18-21)13-15-23(31-26)10-6-4-5-9-17-29;1-3-7(2)4-5(11)9-6(8)10-7/h7-8,11-12,14,16,18,23,25,30H,1,4-6,9-10,13,15,17,19,29H2,2-3H3;3-4H2,1-2H3,(H3,8,9,10,11) |
| InChIKey | UCBWGOQIFABEOK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.83 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|