C35H47N5O — CID 163222838
1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl (1E)-N-[(Z)-3,8-diazabicyclo[3.2.1]octan-3-yl-[1-(8-ethylnaphthalen-1-yl)-3-methylidenepiperidin-4-ylidene]methyl]ethanimidate (PubChem CID 163222838) has the molecular formula C35H47N5O and a molecular weight of 553.80 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl (1E)-N-[(Z)-3,8-diazabicyclo[3.2.1]octan-3-yl-[1-(8-ethylnaphthalen-1-yl)-3-methylidenepiperidin-4-ylidene]methyl]ethanimidate.
| Compound Name | 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl (1E)-N-[(Z)-3,8-diazabicyclo[3.2.1]octan-3-yl-[1-(8-ethylnaphthalen-1-yl)-3-methylidenepiperidin-4-ylidene]methyl]ethanimidate |
|---|---|
| PubChem CID | 163222838 |
| Molecular Formula | C35H47N5O |
| Molecular Weight | 553.80 g/mol |
| Exact Mass | 553.38 |
| IUPAC Name | 1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl (1E)-N-[(Z)-3,8-diazabicyclo[3.2.1]octan-3-yl-[1-(8-ethylnaphthalen-1-yl)-3-methylidenepiperidin-4-ylidene]methyl]ethanimidate |
| SMILES | C=C1CN(c2cccc3cccc(CC)c23)CC/C1=C(/N=C(\C)OCC12CCCN1CCC2)N1CC2CCC(C1)N2 |
| InChI | InChI=1S/C35H47N5O/c1-4-27-9-5-10-28-11-6-12-32(33(27)28)38-20-15-31(25(2)21-38)34(39-22-29-13-14-30(23-39)37-29)36-26(3)41-24-35-16-7-18-40(35)19-8-17-35/h5-6,9-12,29-30,37H,2,4,7-8,13-24H2,1,3H3/b34-31+,36-26+ |
| InChIKey | SRSLSHBHACUFCF-MFKLLRFQSA-N |
| XLogP | 5.88 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|