C31H41N3O — CID 163223224
(Z)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[(Z)-1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)but-1-enyl]methanimine (PubChem CID 163223224) has the molecular formula C31H41N3O and a molecular weight of 471.69 g/mol. Its IUPAC name is (Z)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[(Z)-1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)but-1-enyl]methanimine.
| Compound Name | (Z)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[(Z)-1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)but-1-enyl]methanimine |
|---|---|
| PubChem CID | 163223224 |
| Molecular Formula | C31H41N3O |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | (Z)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[(Z)-1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)but-1-enyl]methanimine |
| SMILES | CC/C=C(/N=C\C1=C(C)CN(c2cccc3cccc(CC)c23)CC1)OCC12CCCN1CCC2 |
| InChI | InChI=1S/C31H41N3O/c1-4-10-29(35-23-31-16-8-18-34(31)19-9-17-31)32-21-27-15-20-33(22-24(27)3)28-14-7-13-26-12-6-11-25(5-2)30(26)28/h6-7,10-14,21H,4-5,8-9,15-20,22-23H2,1-3H3/b29-10-,32-21- |
| InChIKey | KDOOXLWLBUKMSI-GGAQDARUSA-N |
| XLogP | 6.90 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|