C35H49N5O — CID 163222892
(E)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)ethyl]methanimine (PubChem CID 163222892) has the molecular formula C35H49N5O and a molecular weight of 555.81 g/mol. Its IUPAC name is (E)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)ethyl]methanimine.
| Compound Name | (E)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)ethyl]methanimine |
|---|---|
| PubChem CID | 163222892 |
| Molecular Formula | C35H49N5O |
| Molecular Weight | 555.81 g/mol |
| Exact Mass | 555.39 |
| IUPAC Name | (E)-1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1-[1-(8-ethylnaphthalen-1-yl)-5-methyl-3,6-dihydro-2H-pyridin-4-yl]-N-[1-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)ethyl]methanimine |
| SMILES | CCc1cccc2cccc(N3CCC(/C(=N\C(C)OCC45CCCN4CCC5)N4CC5CCC(C4)N5)=C(C)C3)c12 |
| InChI | InChI=1S/C35H49N5O/c1-4-27-9-5-10-28-11-6-12-32(33(27)28)38-20-15-31(25(2)21-38)34(39-22-29-13-14-30(23-39)37-29)36-26(3)41-24-35-16-7-18-40(35)19-8-17-35/h5-6,9-12,26,29-30,37H,4,7-8,13-24H2,1-3H3/b36-34+ |
| InChIKey | AUTHUNHJDMBEGA-JMUUFCRMSA-N |
| XLogP | 5.75 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|