C14H11Cl2N3O — CID 163223098
7-benzyl-2,4-dichloro-5,8-dihydropyrido[3,4-d]pyrimidin-6-one (PubChem CID 163223098) has the molecular formula C14H11Cl2N3O and a molecular weight of 308.17 g/mol. Its IUPAC name is 7-benzyl-2,4-dichloro-5,8-dihydropyrido[3,4-d]pyrimidin-6-one.
| Compound Name | 7-benzyl-2,4-dichloro-5,8-dihydropyrido[3,4-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 163223098 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 7-benzyl-2,4-dichloro-5,8-dihydropyrido[3,4-d]pyrimidin-6-one |
| SMILES | O=C1Cc2c(Cl)nc(Cl)nc2CN1Cc1ccccc1 |
| InChI | InChI=1S/C14H11Cl2N3O/c15-13-10-6-12(20)19(7-9-4-2-1-3-5-9)8-11(10)17-14(16)18-13/h1-5H,6-8H2 |
| InChIKey | ZCXCRZAHUDIZMG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |