C15H16ClN3O — CID 91284509
7-benzyl-4-chloro-5H-pyrrolo[2,3-d]pyrimidin-6-one;ethane (PubChem CID 91284509) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is 7-benzyl-4-chloro-5H-pyrrolo[2,3-d]pyrimidin-6-one;ethane.
| Compound Name | 7-benzyl-4-chloro-5H-pyrrolo[2,3-d]pyrimidin-6-one;ethane |
|---|---|
| PubChem CID | 91284509 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 7-benzyl-4-chloro-5H-pyrrolo[2,3-d]pyrimidin-6-one;ethane |
| SMILES | CC.O=C1Cc2c(Cl)ncnc2N1Cc1ccccc1 |
| InChI | InChI=1S/C13H10ClN3O.C2H6/c14-12-10-6-11(18)17(13(10)16-8-15-12)7-9-4-2-1-3-5-9;1-2/h1-5,8H,6-7H2;1-2H3 |
| InChIKey | BZWZODYRBWZZNL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |