C9H14BrNOS2 — CID 163224948
(S)-N-[(4-bromothiophen-2-yl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 163224948) has the molecular formula C9H14BrNOS2 and a molecular weight of 296.26 g/mol. Its IUPAC name is (S)-N-[(4-bromothiophen-2-yl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(4-bromothiophen-2-yl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163224948 |
| Molecular Formula | C9H14BrNOS2 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | (S)-N-[(4-bromothiophen-2-yl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C9H14BrNOS2/c1-9(2,3)14(12)11-5-8-4-7(10)6-13-8/h4,6,11H,5H2,1-3H3/t14-/m0/s1 |
| InChIKey | SOQTZLKBJRNYJR-AWEZNQCLSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |