C13H22BrNOS2 — CID 163225327
(S)-N-[(1R)-1-(4-bromothiophen-2-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide (PubChem CID 163225327) has the molecular formula C13H22BrNOS2 and a molecular weight of 352.36 g/mol. Its IUPAC name is (S)-N-[(1R)-1-(4-bromothiophen-2-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1R)-1-(4-bromothiophen-2-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163225327 |
| Molecular Formula | C13H22BrNOS2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (S)-N-[(1R)-1-(4-bromothiophen-2-yl)-3-methylbutyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)C[C@@H](N[S@@](=O)C(C)(C)C)c1cc(Br)cs1 |
| InChI | InChI=1S/C13H22BrNOS2/c1-9(2)6-11(12-7-10(14)8-17-12)15-18(16)13(3,4)5/h7-9,11,15H,6H2,1-5H3/t11-,18+/m1/s1 |
| InChIKey | VZDNLXUUNATXHT-ZMZPIMSZSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |