C26H33N5O4S — CID 163225902
(1S,3S,5S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-5-methyl-2-[2-(4-phenoxybutanoylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 163225902) has the molecular formula C26H33N5O4S and a molecular weight of 511.65 g/mol. Its IUPAC name is (1S,3S,5S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-5-methyl-2-[2-(4-phenoxybutanoylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1S,3S,5S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-5-methyl-2-[2-(4-phenoxybutanoylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 163225902 |
| Molecular Formula | C26H33N5O4S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (1S,3S,5S)-N-[(1R)-1-(4-carbamimidoylthiophen-2-yl)ethyl]-5-methyl-2-[2-(4-phenoxybutanoylamino)acetyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | [H]/N=C(\N)c1csc([C@@H](C)NC(=O)[C@@H]2C[C@]3(C)C[C@@H]3N2C(=O)CNC(=O)CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H33N5O4S/c1-16(20-11-17(15-36-20)24(27)28)30-25(34)19-12-26(2)13-21(26)31(19)23(33)14-29-22(32)9-6-10-35-18-7-4-3-5-8-18/h3-5,7-8,11,15-16,19,21H,6,9-10,12-14H2,1-2H3,(H3,27,28)(H,29,32)(H,30,34)/t16-,19+,21+,26-/m1/s1 |
| InChIKey | SITCWYMOBRGXMW-ZSMOFNCSSA-N |
| XLogP | 2.56 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|