C19H32N2O3 — CID 163226216
ethane;formamide;1-(2-methylpyrrolidin-1-yl)-5-phenoxypentan-1-one (PubChem CID 163226216) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;formamide;1-(2-methylpyrrolidin-1-yl)-5-phenoxypentan-1-one.
| Compound Name | ethane;formamide;1-(2-methylpyrrolidin-1-yl)-5-phenoxypentan-1-one |
|---|---|
| PubChem CID | 163226216 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | ethane;formamide;1-(2-methylpyrrolidin-1-yl)-5-phenoxypentan-1-one |
| SMILES | CC.CC1CCCN1C(=O)CCCCOc1ccccc1.NC=O |
| InChI | InChI=1S/C16H23NO2.C2H6.CH3NO/c1-14-8-7-12-17(14)16(18)11-5-6-13-19-15-9-3-2-4-10-15;1-2;2-1-3/h2-4,9-10,14H,5-8,11-13H2,1H3;1-2H3;1H,(H2,2,3) |
| InChIKey | OMMJQCXZTPLRTA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|