C17H14F5NO2 — CID 163227163
methyl 2-amino-4-(2,4-difluorophenyl)-3-ethyl-5-(trifluoromethyl)benzoate (PubChem CID 163227163) has the molecular formula C17H14F5NO2 and a molecular weight of 359.29 g/mol. Its IUPAC name is methyl 2-amino-4-(2,4-difluorophenyl)-3-ethyl-5-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-amino-4-(2,4-difluorophenyl)-3-ethyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 163227163 |
| Molecular Formula | C17H14F5NO2 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | methyl 2-amino-4-(2,4-difluorophenyl)-3-ethyl-5-(trifluoromethyl)benzoate |
| SMILES | CCc1c(N)c(C(=O)OC)cc(C(F)(F)F)c1-c1ccc(F)cc1F |
| InChI | InChI=1S/C17H14F5NO2/c1-3-9-14(10-5-4-8(18)6-13(10)19)12(17(20,21)22)7-11(15(9)23)16(24)25-2/h4-7H,3,23H2,1-2H3 |
| InChIKey | DNUQVFNCPTVGQK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|