C17H17F5N2O2 — CID 164541577
ethane;methyl 2-amino-4-(3,5-difluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoate (PubChem CID 164541577) has the molecular formula C17H17F5N2O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is ethane;methyl 2-amino-4-(3,5-difluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoate.
| Compound Name | ethane;methyl 2-amino-4-(3,5-difluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 164541577 |
| Molecular Formula | C17H17F5N2O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | ethane;methyl 2-amino-4-(3,5-difluoro-2-pyridinyl)-3-methyl-5-(trifluoromethyl)benzoate |
| SMILES | CC.COC(=O)c1cc(C(F)(F)F)c(-c2ncc(F)cc2F)c(C)c1N |
| InChI | InChI=1S/C15H11F5N2O2.C2H6/c1-6-11(13-10(17)3-7(16)5-22-13)9(15(18,19)20)4-8(12(6)21)14(23)24-2;1-2/h3-5H,21H2,1-2H3;1-2H3 |
| InChIKey | GUQLWTLETMXQIG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|