C17H16ClF4NO2 — CID 164542218
2-amino-4-(3-chloro-4-fluorophenyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane (PubChem CID 164542218) has the molecular formula C17H16ClF4NO2 and a molecular weight of 377.77 g/mol. Its IUPAC name is 2-amino-4-(3-chloro-4-fluorophenyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane.
| Compound Name | 2-amino-4-(3-chloro-4-fluorophenyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane |
|---|---|
| PubChem CID | 164542218 |
| Molecular Formula | C17H16ClF4NO2 |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-amino-4-(3-chloro-4-fluorophenyl)-3-methyl-5-(trifluoromethyl)benzoic acid;ethane |
| SMILES | CC.Cc1c(N)c(C(=O)O)cc(C(F)(F)F)c1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H10ClF4NO2.C2H6/c1-6-12(7-2-3-11(17)10(16)4-7)9(15(18,19)20)5-8(13(6)21)14(22)23;1-2/h2-5H,21H2,1H3,(H,22,23);1-2H3 |
| InChIKey | JJONHDNWZXQTBZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|