C54H112N4O4S4 — CID 163227531
1-[2-[2-[4-[2-[2-[bis(2-hydroxydecyl)amino]ethyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]ethyl-(2-hydroxydecyl)amino]decan-2-ol (PubChem CID 163227531) has the molecular formula C54H112N4O4S4 and a molecular weight of 1009.78 g/mol. Its IUPAC name is 1-[2-[2-[4-[2-[2-[bis(2-hydroxydecyl)amino]ethyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]ethyl-(2-hydroxydecyl)amino]decan-2-ol.
| Compound Name | 1-[2-[2-[4-[2-[2-[bis(2-hydroxydecyl)amino]ethyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]ethyl-(2-hydroxydecyl)amino]decan-2-ol |
|---|---|
| PubChem CID | 163227531 |
| Molecular Formula | C54H112N4O4S4 |
| Molecular Weight | 1009.78 g/mol |
| Exact Mass | 1008.76 |
| IUPAC Name | 1-[2-[2-[4-[2-[2-[bis(2-hydroxydecyl)amino]ethyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]ethyl-(2-hydroxydecyl)amino]decan-2-ol |
| SMILES | CCCCCCCCC(O)CN(CCSSCCN1CC(C)N(CCSSCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CC1C)CC(O)CCCCCCCC |
| InChI | InChI=1S/C54H112N4O4S4/c1-7-11-15-19-23-27-31-51(59)45-55(46-52(60)32-28-24-20-16-12-8-2)35-39-63-65-41-37-57-43-50(6)58(44-49(57)5)38-42-66-64-40-36-56(47-53(61)33-29-25-21-17-13-9-3)48-54(62)34-30-26-22-18-14-10-4/h49-54,59-62H,7-48H2,1-6H3 |
| InChIKey | RMGOQSGPPDNMQT-UHFFFAOYSA-N |
| XLogP | 13.19 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.78 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|