C55H114N4O4S4 — CID 170367275
1-[3-[2-[4-[2-[3-[bis(2-hydroxydecyl)amino]propyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]propyl-(2-hydroxynonyl)amino]decan-2-ol (PubChem CID 170367275) has the molecular formula C55H114N4O4S4 and a molecular weight of 1023.81 g/mol. Its IUPAC name is 1-[3-[2-[4-[2-[3-[bis(2-hydroxydecyl)amino]propyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]propyl-(2-hydroxynonyl)amino]decan-2-ol.
| Compound Name | 1-[3-[2-[4-[2-[3-[bis(2-hydroxydecyl)amino]propyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]propyl-(2-hydroxynonyl)amino]decan-2-ol |
|---|---|
| PubChem CID | 170367275 |
| Molecular Formula | C55H114N4O4S4 |
| Molecular Weight | 1023.81 g/mol |
| Exact Mass | 1022.77 |
| IUPAC Name | 1-[3-[2-[4-[2-[3-[bis(2-hydroxydecyl)amino]propyldisulfanyl]ethyl]-2,5-dimethylpiperazin-1-yl]ethyldisulfanyl]propyl-(2-hydroxynonyl)amino]decan-2-ol |
| SMILES | CCCCCCCCC(O)CN(CCCSSCCN1CC(C)N(CCSSCCCN(CC(O)CCCCCCCC)CC(O)CCCCCCCC)CC1C)CC(O)CCCCCCC |
| InChI | InChI=1S/C55H114N4O4S4/c1-7-11-15-19-23-27-33-53(61)47-56(46-52(60)32-26-22-18-14-10-4)36-30-40-64-66-42-38-58-44-51(6)59(45-50(58)5)39-43-67-65-41-31-37-57(48-54(62)34-28-24-20-16-12-8-2)49-55(63)35-29-25-21-17-13-9-3/h50-55,60-63H,7-49H2,1-6H3 |
| InChIKey | AJPAHOQANLSWNK-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.81 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|