C15H15N5O4 — CID 163228217
tert-butyl 2-(5-nitro-1H-pyrazol-3-yl)benzimidazole-1-carboxylate (PubChem CID 163228217) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is tert-butyl 2-(5-nitro-1H-pyrazol-3-yl)benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-(5-nitro-1H-pyrazol-3-yl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 163228217 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | tert-butyl 2-(5-nitro-1H-pyrazol-3-yl)benzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2cc([N+](=O)[O-])[nH]n2)nc2ccccc21 |
| InChI | InChI=1S/C15H15N5O4/c1-15(2,3)24-14(21)19-11-7-5-4-6-9(11)16-13(19)10-8-12(18-17-10)20(22)23/h4-8H,1-3H3,(H,17,18) |
| InChIKey | DBSISCZQUNBMQF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|