C16H23BN4O3 — CID 163228764
1-[(2S)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]tetrazole (PubChem CID 163228764) has the molecular formula C16H23BN4O3 and a molecular weight of 330.20 g/mol. Its IUPAC name is 1-[(2S)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]tetrazole.
| Compound Name | 1-[(2S)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]tetrazole |
|---|---|
| PubChem CID | 163228764 |
| Molecular Formula | C16H23BN4O3 |
| Molecular Weight | 330.20 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-[(2S)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propyl]tetrazole |
| SMILES | C[C@@H](Cn1cnnn1)Oc1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H23BN4O3/c1-12(10-21-11-18-19-20-21)22-14-8-6-7-13(9-14)17-23-15(2,3)16(4,5)24-17/h6-9,11-12H,10H2,1-5H3/t12-/m0/s1 |
| InChIKey | DPDRRDMUPQMQFR-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|