C27H28BrFN2O5 — CID 163229966
N'-(3-bromophenyl)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-5-fluoro-4-[(4-methoxyphenyl)methoxy]benzohydrazide (PubChem CID 163229966) has the molecular formula C27H28BrFN2O5 and a molecular weight of 559.43 g/mol. Its IUPAC name is N'-(3-bromophenyl)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-5-fluoro-4-[(4-methoxyphenyl)methoxy]benzohydrazide.
| Compound Name | N'-(3-bromophenyl)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-5-fluoro-4-[(4-methoxyphenyl)methoxy]benzohydrazide |
|---|---|
| PubChem CID | 163229966 |
| Molecular Formula | C27H28BrFN2O5 |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N'-(3-bromophenyl)-3-(5,5-dimethyl-1,3-dioxan-2-yl)-5-fluoro-4-[(4-methoxyphenyl)methoxy]benzohydrazide |
| SMILES | COc1ccc(COc2c(F)cc(C(=O)NNc3cccc(Br)c3)cc2C2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C27H28BrFN2O5/c1-27(2)15-35-26(36-16-27)22-11-18(25(32)31-30-20-6-4-5-19(28)13-20)12-23(29)24(22)34-14-17-7-9-21(33-3)10-8-17/h4-13,26,30H,14-16H2,1-3H3,(H,31,32) |
| InChIKey | MFPPCDBCMYZDOH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|