About amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate
amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate (PubChem CID 163230115) has the molecular formula C8H9FNO5P
and a molecular weight of 249.13 g/mol. Its IUPAC name is amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate.
Molecular Properties
| Compound Name | amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate |
| PubChem CID | 163230115 |
| Molecular Formula | C8H9FNO5P |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate |
| SMILES | Cc1cc(F)c(OP(=O)(O)ON)c(C=O)c1 |
| InChI | InChI=1S/C8H9FNO5P/c1-5-2-6(4-11)8(7(9)3-5)14-16(12,13)15-10/h2-4H,10H2,1H3,(H,12,13) |
| InChIKey | AOAJSVYJTQFCNX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate?
The IUPAC name of amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate (CID 163230115) is amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate.
What is the SMILES notation for amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate?
The canonical SMILES for amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate is Cc1cc(F)c(OP(=O)(O)ON)c(C=O)c1.
What is the InChIKey of amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate?
The InChIKey is AOAJSVYJTQFCNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FNO5P/c1-5-2-6(4-11)8(7(9)3-5)14-16(12,13)15-10/h2-4H,10H2,1H3,(H,12,13).
What are the key properties of amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate?
amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate has a molecular weight of 249.13 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino (2-fluoro-6-formyl-4-methylphenyl) hydrogen phosphate is sourced from PubChem (CID 163230115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).