C17H16FNO4 — CID 90167369
ethyl 2-(2-fluoro-4,6-dimethylphenoxy)-4-formylpyridine-3-carboxylate (PubChem CID 90167369) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is ethyl 2-(2-fluoro-4,6-dimethylphenoxy)-4-formylpyridine-3-carboxylate.
| Compound Name | ethyl 2-(2-fluoro-4,6-dimethylphenoxy)-4-formylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 90167369 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | ethyl 2-(2-fluoro-4,6-dimethylphenoxy)-4-formylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C=O)ccnc1Oc1c(C)cc(C)cc1F |
| InChI | InChI=1S/C17H16FNO4/c1-4-22-17(21)14-12(9-20)5-6-19-16(14)23-15-11(3)7-10(2)8-13(15)18/h5-9H,4H2,1-3H3 |
| InChIKey | QFZZIGKZKHZXDT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|