C17H13F4NO3 — CID 90166894
ethyl 4-ethenyl-2-[2-fluoro-4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate (PubChem CID 90166894) has the molecular formula C17H13F4NO3 and a molecular weight of 355.29 g/mol. Its IUPAC name is ethyl 4-ethenyl-2-[2-fluoro-4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate.
| Compound Name | ethyl 4-ethenyl-2-[2-fluoro-4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90166894 |
| Molecular Formula | C17H13F4NO3 |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | ethyl 4-ethenyl-2-[2-fluoro-4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate |
| SMILES | C=Cc1ccnc(Oc2ccc(C(F)(F)F)cc2F)c1C(=O)OCC |
| InChI | InChI=1S/C17H13F4NO3/c1-3-10-7-8-22-15(14(10)16(23)24-4-2)25-13-6-5-11(9-12(13)18)17(19,20)21/h3,5-9H,1,4H2,2H3 |
| InChIKey | UMDPPKSUNIBRKA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |