C18H15FN2O3 — CID 90167127
ethyl 2-[5-(cyanomethyl)-2-fluorophenoxy]-4-ethenylpyridine-3-carboxylate (PubChem CID 90167127) has the molecular formula C18H15FN2O3 and a molecular weight of 326.33 g/mol. Its IUPAC name is ethyl 2-[5-(cyanomethyl)-2-fluorophenoxy]-4-ethenylpyridine-3-carboxylate.
| Compound Name | ethyl 2-[5-(cyanomethyl)-2-fluorophenoxy]-4-ethenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 90167127 |
| Molecular Formula | C18H15FN2O3 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | ethyl 2-[5-(cyanomethyl)-2-fluorophenoxy]-4-ethenylpyridine-3-carboxylate |
| SMILES | C=Cc1ccnc(Oc2cc(CC#N)ccc2F)c1C(=O)OCC |
| InChI | InChI=1S/C18H15FN2O3/c1-3-13-8-10-21-17(16(13)18(22)23-4-2)24-15-11-12(7-9-20)5-6-14(15)19/h3,5-6,8,10-11H,1,4,7H2,2H3 |
| InChIKey | KAFNCLNJQGQMIX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |