C18H17ClF3N5O2S — CID 163234279
1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-5-(4-methylsulfonylpiperazin-1-yl)indazole (PubChem CID 163234279) has the molecular formula C18H17ClF3N5O2S and a molecular weight of 459.88 g/mol. Its IUPAC name is 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-5-(4-methylsulfonylpiperazin-1-yl)indazole.
| Compound Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-5-(4-methylsulfonylpiperazin-1-yl)indazole |
|---|---|
| PubChem CID | 163234279 |
| Molecular Formula | C18H17ClF3N5O2S |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 1-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-5-(4-methylsulfonylpiperazin-1-yl)indazole |
| SMILES | CS(=O)(=O)N1CCN(c2ccc3c(cnn3-c3cc(C(F)(F)F)cc(Cl)n3)c2)CC1 |
| InChI | InChI=1S/C18H17ClF3N5O2S/c1-30(28,29)26-6-4-25(5-7-26)14-2-3-15-12(8-14)11-23-27(15)17-10-13(18(20,21)22)9-16(19)24-17/h2-3,8-11H,4-7H2,1H3 |
| InChIKey | LPISJWHWDXTROP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|