C17H17F2N5O3S — CID 163233481
5,7-difluoro-1-[5-(4-methylsulfonylpiperazin-1-yl)-2-pyridinyl]indazol-6-ol (PubChem CID 163233481) has the molecular formula C17H17F2N5O3S and a molecular weight of 409.42 g/mol. Its IUPAC name is 5,7-difluoro-1-[5-(4-methylsulfonylpiperazin-1-yl)-2-pyridinyl]indazol-6-ol.
| Compound Name | 5,7-difluoro-1-[5-(4-methylsulfonylpiperazin-1-yl)-2-pyridinyl]indazol-6-ol |
|---|---|
| PubChem CID | 163233481 |
| Molecular Formula | C17H17F2N5O3S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 5,7-difluoro-1-[5-(4-methylsulfonylpiperazin-1-yl)-2-pyridinyl]indazol-6-ol |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(-n3ncc4cc(F)c(O)c(F)c43)nc2)CC1 |
| InChI | InChI=1S/C17H17F2N5O3S/c1-28(26,27)23-6-4-22(5-7-23)12-2-3-14(20-10-12)24-16-11(9-21-24)8-13(18)17(25)15(16)19/h2-3,8-10,25H,4-7H2,1H3 |
| InChIKey | ODVCULTXTDCAMH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |