C19H18F2N2O — CID 163233595
1-(4-cyclohexylphenyl)-5,7-difluoroindazol-6-ol (PubChem CID 163233595) has the molecular formula C19H18F2N2O and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-(4-cyclohexylphenyl)-5,7-difluoroindazol-6-ol.
| Compound Name | 1-(4-cyclohexylphenyl)-5,7-difluoroindazol-6-ol |
|---|---|
| PubChem CID | 163233595 |
| Molecular Formula | C19H18F2N2O |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(4-cyclohexylphenyl)-5,7-difluoroindazol-6-ol |
| SMILES | Oc1c(F)cc2cnn(-c3ccc(C4CCCCC4)cc3)c2c1F |
| InChI | InChI=1S/C19H18F2N2O/c20-16-10-14-11-22-23(18(14)17(21)19(16)24)15-8-6-13(7-9-15)12-4-2-1-3-5-12/h6-12,24H,1-5H2 |
| InChIKey | QSECVDYWEMLBCT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |