C19H11ClF2N2O2 — CID 171048601
1-[4-(4-chloro-3-hydroxyphenyl)phenyl]-5,7-difluoroindazol-6-ol (PubChem CID 171048601) has the molecular formula C19H11ClF2N2O2 and a molecular weight of 372.76 g/mol. Its IUPAC name is 1-[4-(4-chloro-3-hydroxyphenyl)phenyl]-5,7-difluoroindazol-6-ol.
| Compound Name | 1-[4-(4-chloro-3-hydroxyphenyl)phenyl]-5,7-difluoroindazol-6-ol |
|---|---|
| PubChem CID | 171048601 |
| Molecular Formula | C19H11ClF2N2O2 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 1-[4-(4-chloro-3-hydroxyphenyl)phenyl]-5,7-difluoroindazol-6-ol |
| SMILES | Oc1cc(-c2ccc(-n3ncc4cc(F)c(O)c(F)c43)cc2)ccc1Cl |
| InChI | InChI=1S/C19H11ClF2N2O2/c20-14-6-3-11(8-16(14)25)10-1-4-13(5-2-10)24-18-12(9-23-24)7-15(21)19(26)17(18)22/h1-9,25-26H |
| InChIKey | JJYXPDOXECGZQS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |