C21H23F2N3O2 — CID 163233702
5,7-difluoro-1-[4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]indazol-6-ol (PubChem CID 163233702) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 5,7-difluoro-1-[4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]indazol-6-ol.
| Compound Name | 5,7-difluoro-1-[4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]indazol-6-ol |
|---|---|
| PubChem CID | 163233702 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 5,7-difluoro-1-[4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]indazol-6-ol |
| SMILES | CC1(C)CN(c2ccc(-n3ncc4cc(F)c(O)c(F)c43)cc2)CC(C)(C)O1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-20(2)11-25(12-21(3,4)28-20)14-5-7-15(8-6-14)26-18-13(10-24-26)9-16(22)19(27)17(18)23/h5-10,27H,11-12H2,1-4H3 |
| InChIKey | SJERLRQGXRSRKO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|