C24H24F2N2S — CID 163233630
[4-[4-(5,7-difluoro-6-methylindazol-1-yl)phenyl]phenyl]-methyl-methylidene-λ4-sulfane;ethane (PubChem CID 163233630) has the molecular formula C24H24F2N2S and a molecular weight of 410.53 g/mol. Its IUPAC name is [4-[4-(5,7-difluoro-6-methylindazol-1-yl)phenyl]phenyl]-methyl-methylidene-λ4-sulfane;ethane.
| Compound Name | [4-[4-(5,7-difluoro-6-methylindazol-1-yl)phenyl]phenyl]-methyl-methylidene-λ4-sulfane;ethane |
|---|---|
| PubChem CID | 163233630 |
| Molecular Formula | C24H24F2N2S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [4-[4-(5,7-difluoro-6-methylindazol-1-yl)phenyl]phenyl]-methyl-methylidene-λ4-sulfane;ethane |
| SMILES | C=S(C)c1ccc(-c2ccc(-n3ncc4cc(F)c(C)c(F)c43)cc2)cc1.CC |
| InChI | InChI=1S/C22H18F2N2S.C2H6/c1-14-20(23)12-17-13-25-26(22(17)21(14)24)18-8-4-15(5-9-18)16-6-10-19(11-7-16)27(2)3;1-2/h4-13H,2H2,1,3H3;1-2H3 |
| InChIKey | UDKFTXJLDWSDDO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|