C18H18F3N5O3S — CID 163234438
6-[5-(4-methylsulfonylpiperazin-1-yl)indazol-2-yl]-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 163234438) has the molecular formula C18H18F3N5O3S and a molecular weight of 441.44 g/mol. Its IUPAC name is 6-[5-(4-methylsulfonylpiperazin-1-yl)indazol-2-yl]-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-[5-(4-methylsulfonylpiperazin-1-yl)indazol-2-yl]-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 163234438 |
| Molecular Formula | C18H18F3N5O3S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 6-[5-(4-methylsulfonylpiperazin-1-yl)indazol-2-yl]-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | CS(=O)(=O)N1CCN(c2ccc3nn(-c4cc(C(F)(F)F)cc(=O)[nH]4)cc3c2)CC1 |
| InChI | InChI=1S/C18H18F3N5O3S/c1-30(28,29)25-6-4-24(5-7-25)14-2-3-15-12(8-14)11-26(23-15)16-9-13(18(19,20)21)10-17(27)22-16/h2-3,8-11H,4-7H2,1H3,(H,22,27) |
| InChIKey | HGHVECAAINNKSK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |