C14H13F3N4O5S2 — CID 72700154
2-(4-methylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 72700154) has the molecular formula C14H13F3N4O5S2 and a molecular weight of 438.41 g/mol. Its IUPAC name is 2-(4-methylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 2-(4-methylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 72700154 |
| Molecular Formula | C14H13F3N4O5S2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2-(4-methylsulfonylpiperazin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | CS(=O)(=O)N1CCN(c2nc(=O)c3cc(C(F)(F)F)cc([N+](=O)[O-])c3s2)CC1 |
| InChI | InChI=1S/C14H13F3N4O5S2/c1-28(25,26)20-4-2-19(3-5-20)13-18-12(22)9-6-8(14(15,16)17)7-10(21(23)24)11(9)27-13/h6-7H,2-5H2,1H3 |
| InChIKey | TYJVCVOSHRFLPW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|