C24H24F3N5O4S — CID 57387882
N-methyl-N-(4-methylphenyl)-2-[4-[8-nitro-4-oxo-6-(trifluoromethyl)-1,3-benzothiazin-2-yl]piperazin-1-yl]propanamide (PubChem CID 57387882) has the molecular formula C24H24F3N5O4S and a molecular weight of 535.55 g/mol. Its IUPAC name is N-methyl-N-(4-methylphenyl)-2-[4-[8-nitro-4-oxo-6-(trifluoromethyl)-1,3-benzothiazin-2-yl]piperazin-1-yl]propanamide.
| Compound Name | N-methyl-N-(4-methylphenyl)-2-[4-[8-nitro-4-oxo-6-(trifluoromethyl)-1,3-benzothiazin-2-yl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 57387882 |
| Molecular Formula | C24H24F3N5O4S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-methyl-N-(4-methylphenyl)-2-[4-[8-nitro-4-oxo-6-(trifluoromethyl)-1,3-benzothiazin-2-yl]piperazin-1-yl]propanamide |
| SMILES | Cc1ccc(N(C)C(=O)C(C)N2CCN(c3nc(=O)c4cc(C(F)(F)F)cc([N+](=O)[O-])c4s3)CC2)cc1 |
| InChI | InChI=1S/C24H24F3N5O4S/c1-14-4-6-17(7-5-14)29(3)22(34)15(2)30-8-10-31(11-9-30)23-28-21(33)18-12-16(24(25,26)27)13-19(32(35)36)20(18)37-23/h4-7,12-13,15H,8-11H2,1-3H3 |
| InChIKey | LYYGTLLGTRKHTF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 99.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|