C13H9F3N4O4S — CID 146000917
2-(3-methoxyiminoazetidin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 146000917) has the molecular formula C13H9F3N4O4S and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-(3-methoxyiminoazetidin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 2-(3-methoxyiminoazetidin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 146000917 |
| Molecular Formula | C13H9F3N4O4S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 2-(3-methoxyiminoazetidin-1-yl)-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | CON=C1CN(c2nc(=O)c3cc(C(F)(F)F)cc([N+](=O)[O-])c3s2)C1 |
| InChI | InChI=1S/C13H9F3N4O4S/c1-24-18-7-4-19(5-7)12-17-11(21)8-2-6(13(14,15)16)3-9(20(22)23)10(8)25-12/h2-3H,4-5H2,1H3 |
| InChIKey | XOLSMABVLLZCAR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|