C22H26F3N5O4S — CID 155539792
2-[(2R)-4-[(4-methoxyiminocyclohexyl)methyl]-2-methylpiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one (PubChem CID 155539792) has the molecular formula C22H26F3N5O4S and a molecular weight of 513.54 g/mol. Its IUPAC name is 2-[(2R)-4-[(4-methoxyiminocyclohexyl)methyl]-2-methylpiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one.
| Compound Name | 2-[(2R)-4-[(4-methoxyiminocyclohexyl)methyl]-2-methylpiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 155539792 |
| Molecular Formula | C22H26F3N5O4S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[(2R)-4-[(4-methoxyiminocyclohexyl)methyl]-2-methylpiperazin-1-yl]-8-nitro-6-(trifluoromethyl)-1,3-benzothiazin-4-one |
| SMILES | CON=C1CCC(CN2CCN(c3nc(=O)c4cc(C(F)(F)F)cc([N+](=O)[O-])c4s3)[C@H](C)C2)CC1 |
| InChI | InChI=1S/C22H26F3N5O4S/c1-13-11-28(12-14-3-5-16(6-4-14)27-34-2)7-8-29(13)21-26-20(31)17-9-15(22(23,24)25)10-18(30(32)33)19(17)35-21/h9-10,13-14H,3-8,11-12H2,1-2H3/b27-16-/t13-,14?/m1/s1 |
| InChIKey | QWHBCSUGSNXUPQ-RKRQSSQFSA-N |
| XLogP | 4.29 |
| TPSA | 101.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|